CymitQuimica logo

CAS 947533-23-5

:

B-[4-(Cyanomethoxy)phenyl]boronic acid

Description:
B-[4-(Cyanomethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a cyanomethoxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The cyanomethoxy substituent enhances its reactivity and solubility in organic solvents. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in the synthesis of complex organic molecules. The presence of the cyano group may also impart unique electronic properties, potentially influencing the compound's reactivity and interaction with biological targets. Overall, B-[4-(Cyanomethoxy)phenyl]boronic acid is a versatile compound with significant implications in both synthetic and pharmaceutical chemistry.
Formula:C8H8BNO3
InChI:InChI=1S/C8H8BNO3/c10-5-6-13-8-3-1-7(2-4-8)9(11)12/h1-4,11-12H,6H2
InChI key:InChIKey=GKJPNYHKHSLHCC-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(OCC#N)C=C1
Synonyms:
  • Boronic acid, B-[4-(cyanomethoxy)phenyl]-
  • 4-(Cyanomethoxy)phenylboronic acid
  • B-[4-(Cyanomethoxy)phenyl]boronic acid
Found 4 products.