
CAS 947533-74-6
:5-Bromo-2-(1,1-dimethylethyl)imidazo[1,2-a]pyridine
Description:
5-Bromo-2-(1,1-dimethylethyl)imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 5-position and a bulky tert-butyl group at the 2-position enhances its lipophilicity and may influence its reactivity and biological activity. This compound is typically used in medicinal chemistry and research due to its potential as a pharmacophore in drug development. Its structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the imidazo[1,2-a]pyridine framework is known for its presence in several bioactive compounds, which may exhibit diverse pharmacological effects. The compound's stability, solubility, and reactivity can be influenced by the electronic effects of the bromine and the tert-butyl group, making it an interesting subject for further study in both synthetic and medicinal chemistry contexts.
Formula:C11H13BrN2
InChI:InChI=1S/C11H13BrN2/c1-11(2,3)8-7-14-9(12)5-4-6-10(14)13-8/h4-7H,1-3H3
InChI key:InChIKey=INXAQVQNJAHQJX-UHFFFAOYSA-N
SMILES:BrC=1N2C(=NC(C(C)(C)C)=C2)C=CC1
Synonyms:- 5-Bromo-2-(1,1-dimethylethyl)imidazo[1,2-a]pyridine
- Imidazo[1,2-a]pyridine, 5-bromo-2-(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.