CAS 947533-98-4

5,8-Dioxa-2-azaspiro[3.4]octane, hydrochloride (1:1)

Description:

5,8-Dioxa-2-azaspiro[3.4]octane, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen atoms within its framework. This compound features a bicyclic system that includes a nitrogen atom in a five-membered ring and two oxygen atoms, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. Such compounds are of interest in medicinal chemistry due to their potential pharmacological properties, including effects on neurotransmitter systems. The presence of the spiro structure may also influence its conformational flexibility and interaction with biological targets. As with many chemical substances, safety and handling precautions should be observed, particularly in laboratory settings, due to the potential for toxicity or reactivity. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₅H₉NO₂·ClH

InChI: InChI=1S/C5H9NO2.ClH/c1-2-8-5(7-1)3-6-4-5;/h6H,1-4H2;1H

InChI key: InChIKey=QOPGEYCLVHZLGP-UHFFFAOYSA-N

SMILES: C12(OCCO1)CNC2.Cl

Synonyms:

• 5,8-Dioxa-2-azaspiro[3.4]octane, hydrochloride (1:1)

5,8-dioxa-2-azaspiro[3.4]octane;hydrochloride

CAS: 947533-98-4

Formula: C₅H₁₀ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 151.5914

Ref: IN-DA01JUSQ

5,8-Dioxa-2-azaspiro[3.4]octane hydrochloride

CAS: 947533-98-4

5,8-Dioxa-2-azaspiro[3.4]octane hydrochloride

Purity: 98%

Molecular weight: 151.59g/mol

Ref: 54-OR93220

5,8-Dioxa-2-azaspiro[3.4]octane hydrochloride

CAS: 947533-98-4

Purity: 98%

Molecular weight: 151.5899963

Ref: 10-F616692