CymitQuimica logo

CAS 947534-32-9

:

2-(Cyclobutylmethoxy)-5-nitropyridine

Description:
2-(Cyclobutylmethoxy)-5-nitropyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a nitro group and a cyclobutylmethoxy group. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and potential applications in organic synthesis or medicinal chemistry. The cyclobutylmethoxy moiety contributes to the compound's steric and electronic properties, potentially affecting its solubility and interaction with biological targets. This compound may exhibit interesting pharmacological activities due to its structural features, making it a candidate for further research in drug development. Additionally, the presence of both a heterocyclic ring and functional groups suggests potential for diverse chemical reactivity, including nucleophilic substitutions or coupling reactions. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would be essential for practical applications and would typically be determined through experimental methods. Overall, 2-(Cyclobutylmethoxy)-5-nitropyridine represents a complex structure with potential utility in various chemical and pharmaceutical contexts.
Formula:C10H12N2O3
InChI:InChI=1S/C10H12N2O3/c13-12(14)9-4-5-10(11-6-9)15-7-8-2-1-3-8/h4-6,8H,1-3,7H2
InChI key:InChIKey=JQLCPQKFLHRBHF-UHFFFAOYSA-N
SMILES:O(CC1CCC1)C2=CC=C(N(=O)=O)C=N2
Synonyms:
  • 2-(Cyclobutylmethoxy)-5-nitropyridine
  • Pyridine, 2-(cyclobutylmethoxy)-5-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.