
CAS 947534-33-0
:5-Bromo-N-cyclobutyl-2-pyrimidinamine
Description:
5-Bromo-N-cyclobutyl-2-pyrimidinamine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a bromine atom and a cyclobutyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the pyrimidine and cyclobutyl moieties. It is likely to be a solid at room temperature, with moderate solubility in polar organic solvents, reflecting the influence of its functional groups. The bromine substitution can impart specific reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the cyclobutyl group may contribute to its steric properties, influencing its biological activity and interactions with other molecules. As a pyrimidinamine derivative, it may also exhibit potential pharmacological properties, making it of interest in medicinal chemistry. Overall, the compound's characteristics are defined by its molecular structure, which influences its physical and chemical behavior in various environments.
Formula:C8H10BrN3
InChI:InChI=1S/C8H10BrN3/c9-6-4-10-8(11-5-6)12-7-2-1-3-7/h4-5,7H,1-3H2,(H,10,11,12)
InChI key:InChIKey=ZNYRNULCKWWGRG-UHFFFAOYSA-N
SMILES:N(C=1N=CC(Br)=CN1)C2CCC2
Synonyms:- 5-Bromo-N-cyclobutyl-2-pyrimidinamine
- 2-Pyrimidinamine, 5-bromo-N-cyclobutyl-
- 5-Bromo-2-(cyclobutylamino)-pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.