CAS 947534-36-3
:5-Bromo-1,2-difluoro-3-(2,2,2-trifluoroethoxy)benzene
Description:
5-Bromo-1,2-difluoro-3-(2,2,2-trifluoroethoxy)benzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and two fluorine atoms substituted on the benzene ring, along with a trifluoroethoxy group. The presence of the bromine and fluorine atoms contributes to its unique chemical properties, such as increased electronegativity and potential reactivity in nucleophilic substitution reactions. The trifluoroethoxy group enhances the compound's lipophilicity and may influence its solubility in organic solvents. This compound is likely to exhibit significant thermal stability due to the strong C-F bonds, making it suitable for various applications in pharmaceuticals, agrochemicals, or materials science. Additionally, the presence of multiple halogen substituents can affect its biological activity and environmental persistence. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental impact. Overall, 5-Bromo-1,2-difluoro-3-(2,2,2-trifluoroethoxy)benzene is a complex molecule with distinct characteristics that make it of interest in various chemical research fields.
Formula:C8H4BrF5O
InChI:InChI=1S/C8H4BrF5O/c9-4-1-5(10)7(11)6(2-4)15-3-8(12,13)14/h1-2H,3H2
InChI key:InChIKey=MTBBOJFBRGIUHC-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C1=C(F)C(F)=CC(Br)=C1
Synonyms:- Benzene, 5-bromo-1,2-difluoro-3-(2,2,2-trifluoroethoxy)-
- 5-Bromo-1,2-difluoro-3-(2,2,2-trifluoroethoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.