CAS 947534-37-4

5-Bromo-1-(2,2-difluoroethoxy)-2,3-difluorobenzene

Description:

5-Bromo-1-(2,2-difluoroethoxy)-2,3-difluorobenzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and multiple fluorine substituents. The presence of the bromine atom at the 5-position and the difluoroethoxy group at the 1-position contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The difluorobenzene moiety enhances the compound's lipophilicity and may influence its electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the fluorine atoms can impart unique characteristics such as increased stability and altered solubility compared to non-fluorinated analogs. This compound may be utilized in the synthesis of more complex molecules or as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific physical properties, such as boiling point, melting point, and solubility, would need to be determined experimentally or sourced from chemical databases for practical applications.

Formula: C₈H₅BrF₄O

InChI: InChI=1S/C8H5BrF4O/c9-4-1-5(10)8(13)6(2-4)14-3-7(11)12/h1-2,7H,3H2

InChI key: InChIKey=GOMLZMRDYIKXMR-UHFFFAOYSA-N

SMILES: O(CC(F)F)C1=C(F)C(F)=CC(Br)=C1

Synonyms:

• Benzene, 5-bromo-1-(2,2-difluoroethoxy)-2,3-difluoro-
• 5-Bromo-1-(2,2-difluoroethoxy)-2,3-difluorobenzene