CymitQuimica logo

CAS 947534-66-9

:

1-Azetidinyl(4-bromo-2-pyridinyl)methanone

Description:
1-Azetidinyl(4-bromo-2-pyridinyl)methanone, identified by its CAS number 947534-66-9, is a chemical compound that features a unique structure combining an azetidine ring and a pyridine moiety. The azetidine ring is a four-membered saturated heterocycle, which contributes to the compound's potential biological activity. The presence of the 4-bromo-2-pyridinyl group introduces halogen substitution, which can influence the compound's reactivity and interaction with biological targets. This compound may exhibit properties such as moderate to high polarity due to the presence of the carbonyl group in the methanone functional group, which can engage in hydrogen bonding. Additionally, the overall molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their therapeutic effects. However, specific physical properties such as melting point, boiling point, and solubility would require empirical determination or literature reference for precise characterization.
Formula:C9H9BrN2O
InChI:InChI=1S/C9H9BrN2O/c10-7-2-3-11-8(6-7)9(13)12-4-1-5-12/h2-3,6H,1,4-5H2
InChI key:InChIKey=KQNQGXLZQVBIRC-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Br)=CC=N1)N2CCC2
Synonyms:
  • 1-Azetidinyl(4-bromo-2-pyridinyl)methanone
  • Methanone, 1-azetidinyl(4-bromo-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.