
CAS 947534-74-9
:6-(4-Bromophenyl)imidazo[1,2-d]-1,2,4-thiadiazole
Description:
6-(4-Bromophenyl)imidazo[1,2-d]-1,2,4-thiadiazole is a heterocyclic compound characterized by its imidazole and thiadiazole rings, which contribute to its unique chemical properties. The presence of the 4-bromophenyl group enhances its lipophilicity and may influence its biological activity. This compound typically exhibits a solid-state at room temperature and may be soluble in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both nitrogen and sulfur atoms that can participate in various chemical interactions. The compound may also display interesting electronic properties, making it a candidate for studies in materials science. Additionally, its bromine substituent can facilitate further chemical modifications, allowing for the synthesis of derivatives with tailored properties. Overall, 6-(4-Bromophenyl)imidazo[1,2-d]-1,2,4-thiadiazole is a versatile compound with potential applications in various fields, including drug discovery and materials development.
Formula:C10H6BrN3S
InChI:InChI=1S/C10H6BrN3S/c11-8-3-1-7(2-4-8)9-5-14-6-12-15-10(14)13-9/h1-6H
InChI key:InChIKey=GIDIPYHYLCYSMQ-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C2=CN3C(=N2)SN=C3)C=C1
Synonyms:- Imidazo[1,2-d]-1,2,4-thiadiazole, 6-(4-bromophenyl)-
- 6-(4-Bromophenyl)imidazo[1,2-d]-1,2,4-thiadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.