CAS 947601-83-4

Methanaminium, N,N,N-trimethyl-, 11-aminoundecanoate (1:1)

Description:

Methanaminium, N,N,N-trimethyl-, 11-aminoundecanoate (1:1), with CAS number 947601-83-4, is a quaternary ammonium compound characterized by its trimethylated nitrogen atom and a long-chain fatty acid derivative. This compound features a methanaminium core, which is positively charged due to the presence of three methyl groups attached to the nitrogen atom, enhancing its solubility in polar solvents. The 11-aminoundecanoate portion contributes a hydrophobic alkyl chain, typically associated with surfactant properties, making it useful in various applications, including as a surfactant, emulsifier, or in drug delivery systems. The presence of both hydrophilic and hydrophobic regions allows for amphiphilic behavior, which is crucial in forming micelles or stabilizing emulsions. Additionally, the compound may exhibit antimicrobial properties, making it relevant in pharmaceutical and cosmetic formulations. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications.

Formula: C₁₁H₂₂NO₂·C₄H₁₂N

InChI: InChI=1S/C11H23NO2.C4H12N/c12-10-8-6-4-2-1-3-5-7-9-11(13)14;1-5(2,3)4/h1-10,12H2,(H,13,14);1-4H3/q;+1/p-1

InChI key: InChIKey=VREIIGDEUQSHDP-UHFFFAOYSA-M

SMILES: C(CCCCCCCN)CCC([O-])=O.[N+](C)(C)(C)C

Synonyms:

• Methanaminium, N,N,N-trimethyl-, 11-aminoundecanoate (1:1)