CAS 947601-96-9
:2,2,2-trideuterio-N-[4-(2-hydroxy-5-methyl-phenyl)azophenyl]acetamide
Description:
2,2,2-Trideuterio-N-[4-(2-hydroxy-5-methyl-phenyl)azophenyl]acetamide is a deuterated compound, which means it contains three deuterium atoms, a stable isotope of hydrogen. This compound features an acetamide functional group, which is characterized by the presence of a carbonyl group (C=O) adjacent to a nitrogen atom (N). The azophenyl moiety indicates that it contains an azo group (-N=N-) linking two aromatic rings, one of which is substituted with a hydroxyl group and a methyl group, contributing to its overall polarity and potential for hydrogen bonding. The presence of deuterium can influence the compound's physical and chemical properties, such as its solubility and reactivity, compared to its non-deuterated counterparts. This compound may be used in various applications, including as a tracer in chemical reactions or in studies involving isotopic labeling. Its unique structure and isotopic composition make it a valuable tool in research, particularly in fields like medicinal chemistry and materials science.
Formula:C15H12D3N3O2
InChI:InChI=1/C15H15N3O2/c1-10-3-8-15(20)14(9-10)18-17-13-6-4-12(5-7-13)16-11(2)19/h3-9,20H,1-2H3,(H,16,19)/b18-17+/i2D3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Disperse Yellow 3 D3 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C15H3H12N3O2Color and Shape:Single SolutionMolecular weight:272.32Disperse Yellow 3-d3
CAS:Controlled ProductFormula:C15H3H12N3O2Color and Shape:NeatMolecular weight:272.32

