CAS 947601-97-0

2-[Ethyl-2,2,2-d3-[4-[(1Z)-2-(4-nitrophenyl)diazenyl]phenyl]amino]ethanol

Description:

2-[Ethyl-2,2,2-d3-[4-[(1Z)-2-(4-nitrophenyl)diazenyl]phenyl]amino]ethanol is a complex organic compound characterized by its unique molecular structure, which includes an ethyl group, a diazenyl moiety, and a nitrophenyl group. The presence of deuterium (d3) indicates that the compound has been isotopically labeled, which can be useful in various analytical applications, including tracing and studying reaction mechanisms. The compound features an amino group, which can participate in hydrogen bonding and influence its solubility and reactivity. Additionally, the nitrophenyl group contributes to the compound's electronic properties, potentially affecting its color and absorption characteristics. This compound may be of interest in fields such as medicinal chemistry, materials science, or analytical chemistry, particularly in the development of dyes or probes due to its azo linkage and aromatic components. Its specific properties, such as solubility, melting point, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.

Formula: C₁₆H₁₅D₃N₄O₃

InChI: InChI=1S/C16H18N4O3/c1-2-19(11-12-21)15-7-3-13(4-8-15)17-18-14-5-9-16(10-6-14)20(22)23/h3-10,21H,2,11-12H2,1H3/i1D3

InChI key: InChIKey=FOQABOMYTOFLPZ-FIBGUPNXSA-N

SMILES: N(CCO)(CC([2H])([2H])[2H])C1=CC=C(N=NC2=CC=C(N(=O)=O)C=C2)C=C1

Synonyms:

• 2-[Ethyl-2,2,2-d3-[4-[(1Z)-2-(4-nitrophenyl)diazenyl]phenyl]amino]ethanol
• Ethanol, 2-[ethyl-2,2,2-d3-[4-[(1Z)-2-(4-nitrophenyl)diazenyl]phenyl]amino]-

Disperse Red 1 D3 (N-ethyl-2,2,2-D3)

Controlled Product

CAS: 947601-97-0

Formula: C₁₆D₃H₁₅N₄O₃

Color and Shape: Neat

Molecular weight: 317.36

Ref: 04-C12972211