
CAS 947617-96-1
:7-Fluoro-4,5-dihydro-1′-(phenylmethyl)spiro[1,5-benzoxazepine-2(3H),4′-piperidine]
Description:
7-Fluoro-4,5-dihydro-1′-(phenylmethyl)spiro[1,5-benzoxazepine-2(3H),4′-piperidine] is a complex organic compound characterized by its unique spirocyclic structure, which combines a benzoxazepine moiety with a piperidine ring. The presence of a fluorine atom at the 7-position contributes to its potential biological activity, possibly influencing its pharmacological properties. The compound features a phenylmethyl group, which may enhance lipophilicity and facilitate interactions with biological targets. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's synthesis and characterization would typically involve advanced organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its identity and purity. Additionally, the compound's solubility, stability, and reactivity would be important factors to consider in its practical applications. Overall, this substance represents a class of compounds that may exhibit interesting biological activities, warranting further investigation in drug discovery and development.
Formula:C20H23FN2O
InChI:InChI=1S/C20H23FN2O/c21-17-6-7-19-18(14-17)22-11-8-20(24-19)9-12-23(13-10-20)15-16-4-2-1-3-5-16/h1-7,14,22H,8-13,15H2
InChI key:InChIKey=OIMOIMLSQGFHJP-UHFFFAOYSA-N
SMILES:C(N1CCC2(OC=3C(NCC2)=CC(F)=CC3)CC1)C4=CC=CC=C4
Synonyms:- 7-Fluoro-4,5-dihydro-1′-(phenylmethyl)spiro[1,5-benzoxazepine-2(3H),4′-piperidine]
- Spiro[1,5-benzoxazepine-2(3H),4′-piperidine], 7-fluoro-4,5-dihydro-1′-(phenylmethyl)-
- 1′-Benzyl-7-fluorospiro[4,5-dihydro-3H-1,5-benzoxazepine-2,4′-piperidine]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.