CymitQuimica logo

CAS 947662-64-8

:

1-thiazol-2-ylethanamine hydrochloride

Description:
1-Thiazol-2-ylethanamine hydrochloride is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing both sulfur and nitrogen atoms. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The thiazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. The amine functional group in the structure may also impart basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any potential hazards associated with its use. Overall, 1-thiazol-2-ylethanamine hydrochloride is a compound of interest in medicinal chemistry and related fields.
Formula:C5H9ClN2S
InChI:InChI=1/C5H8N2S.ClH/c1-4(6)5-7-2-3-8-5;/h2-4H,6H2,1H3;1H
InChI key:KLQZMXLICFMMGL-UHFFFAOYSA-N
SMILES:CC(c1nccs1)N.Cl
Synonyms:
  • 1-(1,3-Thiazol-2-yl)ethanamine hydrochloride (1:1)
  • 2-Thiazolemethanamine, α-methyl-, hydrochloride (1:1)
Found 4 products.