
CAS 94767-49-4
:4,5-Dihydro-6-methyl-4-(2-propen-1-yl)-3(2H)-pyridazinone
Description:
4,5-Dihydro-6-methyl-4-(2-propen-1-yl)-3(2H)-pyridazinone, identified by its CAS number 94767-49-4, is a heterocyclic organic compound characterized by a pyridazinone core structure. This compound features a dihydro-pyridazine ring, which contributes to its potential biological activity. The presence of a methyl group and a propenyl substituent enhances its chemical reactivity and may influence its interactions in biological systems. Typically, compounds of this nature are studied for their pharmacological properties, including potential anti-inflammatory or antimicrobial effects. The molecular structure suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, due to the presence of double bonds. Additionally, the compound's solubility and stability can be influenced by its functional groups, making it of interest in medicinal chemistry and drug development. Overall, 4,5-Dihydro-6-methyl-4-(2-propen-1-yl)-3(2H)-pyridazinone represents a class of compounds that may offer valuable insights into new therapeutic agents.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-3-4-7-5-6(2)9-10-8(7)11/h3,7H,1,4-5H2,2H3,(H,10,11)
InChI key:InChIKey=GPZWZRHWOZYNKU-UHFFFAOYSA-N
SMILES:C(C=C)C1C(=O)NN=C(C)C1
Synonyms:- 3(2H)-Pyridazinone, 4,5-dihydro-6-methyl-4-(2-propen-1-yl)-
- 3(2H)-Pyridazinone, 4,5-dihydro-6-methyl-4-(2-propenyl)-
- 4,5-Dihydro-6-methyl-4-(2-propen-1-yl)-3(2H)-pyridazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
