CAS 947684-78-8

tert-butyl (2R)-2-benzylpiperazine-1-carboxylate

Description:

Tert-butyl (2R)-2-benzylpiperazine-1-carboxylate is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a tert-butyl group, which is a bulky substituent that can influence its solubility and steric properties. The presence of the benzyl group adds aromatic characteristics, potentially affecting its reactivity and interaction with biological targets. The carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its stereochemistry, indicated by the (2R) designation, suggests that it has a specific spatial arrangement that could be crucial for its biological activity. Overall, tert-butyl (2R)-2-benzylpiperazine-1-carboxylate is a complex molecule with potential applications in drug design and development, owing to its unique structural features.

Formula: C₁₆H₂₄N₂O₂

InChI: InChI=1/C16H24N2O2/c1-16(2,3)20-15(19)18-10-9-17-12-14(18)11-13-7-5-4-6-8-13/h4-8,14,17H,9-12H2,1-3H3/t14-/m1/s1

SMILES: CC(C)(C)OC(=O)N1CCNC[C@H]1Cc1ccccc1

Synonyms:

• 2-Methyl-2-propanyl (2R)-2-benzyl-1-piperazinecarboxylate
• tert-Butyl-(2R)-2-benzylpiperazin-1-carboxylat
• tert-Butyl (2R)-2-benzylpiperazine-1-carboxylate

(R)-tert-Butyl 2-benzylpiperazine-1-carboxylate

CAS: 947684-78-8

Formula: C₁₆H₂₄N₂O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 276.3740

Ref: IN-DA003C7X

(R)-1-Boc-2-benzyl-piperazine

CAS: 947684-78-8

(R)-1-Boc-2-benzyl-piperazine

Purity: 97%

Molecular weight: 276.37g/mol

Ref: 54-OR90940

(R)-1-Boc-2-Benzylpiperazine

CAS: 947684-78-8

Formula: C₁₆H₂₄N₂O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 276.38

Ref: 10-F093778