CAS 947691-81-8

6-Bromobenzo[d]isothiazole-3-carboxamide

Description:

6-Bromobenzo[d]isothiazole-3-carboxamide is a chemical compound characterized by its unique structure, which includes a bromine atom, a benzo[d]isothiazole ring, and a carboxamide functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the bromine atom can enhance its lipophilicity and influence its reactivity, making it a candidate for various applications in medicinal chemistry and material science. The carboxamide group contributes to its solubility in polar solvents and can participate in hydrogen bonding, which may affect its pharmacokinetic properties. Additionally, compounds of this class may exhibit antimicrobial, anti-inflammatory, or anticancer activities, although specific biological activities would depend on further empirical studies. Overall, 6-Bromobenzo[d]isothiazole-3-carboxamide represents a versatile scaffold for the development of novel therapeutic agents.

Formula: C₈H₅BrN₂OS

InChI: InChI=1/C8H5BrN2OS/c9-4-1-2-5-6(3-4)13-11-7(5)8(10)12/h1-3H,(H2,10,12)

SMILES: c1cc2c(cc1Br)snc2C(=O)N

Synonyms:

• 6-Bromo-1,2-benzisothiazole-3-carboxamide