CAS 947701-81-7

10-Undecen-1-yl 2-cyano-3,3-diphenyl-2-propenoate

Description:

10-Undecen-1-yl 2-cyano-3,3-diphenyl-2-propenoate, with the CAS number 947701-81-7, is an organic compound characterized by its unique structure that includes a long undecenyl chain and a cyanoacrylate moiety. This compound features a double bond in the undecenyl chain, which contributes to its reactivity and potential applications in polymer chemistry and materials science. The presence of the cyano group and the diphenyl substituents enhances its electronic properties, making it suitable for various chemical reactions, including polymerization processes. Additionally, the compound may exhibit interesting physical properties such as solubility in organic solvents and potential UV-absorbing characteristics due to its conjugated system. Its structural features suggest potential applications in fields such as coatings, adhesives, and as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.

Formula: C₂₇H₃₁NO₂

InChI: InChI=1S/C27H31NO2/c1-2-3-4-5-6-7-8-9-16-21-30-27(29)25(22-28)26(23-17-12-10-13-18-23)24-19-14-11-15-20-24/h2,10-15,17-20H,1,3-9,16,21H2

InChI key: InChIKey=ZMIFHAGGIBCROR-UHFFFAOYSA-N

SMILES: C(=C(C(OCCCCCCCCCC=C)=O)C#N)(C1=CC=CC=C1)C2=CC=CC=C2

Synonyms:

• 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 10-undecen-1-yl ester
• 10-Undecen-1-yl 2-cyano-3,3-diphenyl-2-propenoate

10-Undecenyl 2-Cyano-3,3-diphenylpropenoate

Controlled Product

CAS: 947701-81-7

Formula: C₂₇H₃₁NO₂

Color and Shape: Neat

Molecular weight: 401.541

Ref: TR-U788860