CymitQuimica logo

CAS 947701-96-4

:

ethyl 2-oxo-2-(2-phenylphenyl)acetate

Description:
Ethyl 2-oxo-2-(2-phenylphenyl)acetate, identified by its CAS number 947701-96-4, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a phenyl-substituted structure, which contributes to its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and fine chemicals. The presence of the ethyl group enhances its solubility in organic solvents, making it suitable for various chemical reactions. Additionally, the compound may exhibit interesting optical and electronic properties due to the conjugated system formed by the phenyl rings. Its reactivity can be attributed to the carbonyl group, which is susceptible to nucleophilic attack, allowing for further derivatization. While specific physical properties such as boiling point, melting point, and density are not detailed here, compounds of this nature typically exhibit moderate volatility and stability under standard conditions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c1-2-19-16(18)15(17)14-11-7-6-10-13(14)12-8-4-3-5-9-12/h3-11H,2H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.