CAS 94788-69-9

(7R)-3-[(acetyloxy)methyl]-7-{[fluoro(thiophen-2-yl)acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

Description:

The chemical substance with the name "(7R)-3-[(acetyloxy)methyl]-7-{[fluoro(thiophen-2-yl)acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid" and CAS number "94788-69-9" is a complex bicyclic compound that features a thiazolidine ring structure, which is characteristic of certain antibiotic classes. This compound contains multiple functional groups, including an acetyloxy group, a fluoro-substituted thiophene moiety, and an amino group, contributing to its potential biological activity. The presence of the oxo group and the carboxylic acid functionality suggests that it may exhibit acidic properties, influencing its solubility and reactivity. The stereochemistry indicated by the (7R) designation implies specific spatial arrangements that can affect the compound's interaction with biological targets. Overall, this substance is likely to be of interest in medicinal chemistry, particularly in the development of novel therapeutics, due to its unique structural features and potential pharmacological properties.

Formula: C₁₆H₁₅FN₂O₆S₂

InChI: InChI=1/C16H15FN2O6S2/c1-7(20)25-5-8-6-27-15-11(14(22)19(15)12(8)16(23)24)18-13(21)10(17)9-3-2-4-26-9/h2-4,10-11,15H,5-6H2,1H3,(H,18,21)(H,23,24)/t10?,11-,15?/m1/s1

SMILES: CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@H](C2SC1)N=C(C(c1cccs1)F)O