CAS 948-94-7

N-(2,2-difluoro-1,3-benzodioxol-5-yl)acetamide

Description:

N-(2,2-difluoro-1,3-benzodioxol-5-yl)acetamide is a chemical compound characterized by its unique structure, which includes a benzodioxole moiety substituted with two fluorine atoms and an acetamide functional group. This compound typically exhibits properties associated with both aromatic and amide functionalities, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of fluorine atoms often enhances lipophilicity and can influence the compound's reactivity and biological activity. The benzodioxole structure may contribute to specific interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the acetamide group can participate in hydrogen bonding, which may affect the compound's interactions with other molecules. Overall, N-(2,2-difluoro-1,3-benzodioxol-5-yl)acetamide is a compound of interest for research in various fields, including pharmaceuticals and materials science, due to its distinctive chemical properties and potential applications.

Formula: C₉H₇F₂NO₃

InChI: InChI=1/C9H7F2NO3/c1-5(13)12-6-2-3-7-8(4-6)15-9(10,11)14-7/h2-4H,1H3,(H,12,13)

SMILES: CC(=Nc1ccc2c(c1)OC(F)(F)O2)O