CymitQuimica logo

CAS 94800-92-7

:

ethyl 2,2-dimethyl-3-phenylpropanoate

Description:
Ethyl 2,2-dimethyl-3-phenylpropanoate, with the CAS number 94800-92-7, is an organic compound belonging to the class of esters. It is characterized by its ester functional group, which is formed from the reaction of an alcohol (in this case, ethanol) and a carboxylic acid derivative. This compound features a branched alkyl chain, specifically with two methyl groups attached to the second carbon and a phenyl group at the third carbon, contributing to its unique structure and properties. Ethyl 2,2-dimethyl-3-phenylpropanoate is typically a colorless to pale yellow liquid with a pleasant, fruity aroma, making it potentially useful in flavoring and fragrance applications. Its solubility in organic solvents and limited solubility in water are typical for esters, reflecting its hydrophobic nature. Additionally, it may exhibit moderate volatility and stability under standard conditions, although specific reactivity and safety data should be consulted for handling and usage. Overall, this compound exemplifies the diverse chemistry of esters and their applications in various industries.
Formula:C13H18O2
InChI:InChI=1/C13H18O2/c1-4-15-12(14)13(2,3)10-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3
SMILES:CCOC(=O)C(C)(C)Cc1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.