CymitQuimica logo

CAS 948007-47-4

:

1-(6-Amino-1,3-benzodioxol-5-yl)-2-pyrrolidinone

Description:
1-(6-Amino-1,3-benzodioxol-5-yl)-2-pyrrolidinone, identified by its CAS number 948007-47-4, is a chemical compound that features a pyrrolidinone ring fused with a benzodioxole moiety. This compound is characterized by the presence of an amino group, which contributes to its potential as a bioactive molecule. The benzodioxole structure is known for its role in various pharmacological activities, while the pyrrolidinone ring can enhance solubility and stability. The compound may exhibit properties such as antioxidant, anti-inflammatory, or neuroprotective effects, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to therapeutic applications. However, detailed studies on its pharmacokinetics, toxicity, and specific biological activities are essential for understanding its full potential and safety profile. As with many compounds in drug discovery, further research is necessary to elucidate its mechanisms of action and efficacy in relevant biological systems.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c12-7-4-9-10(16-6-15-9)5-8(7)13-3-1-2-11(13)14/h4-5H,1-3,6,12H2
InChI key:InChIKey=OVYGAIMQFUHCGG-UHFFFAOYSA-N
SMILES:NC1=C(C=C2C(=C1)OCO2)N3C(=O)CCC3
Synonyms:
  • 1-(6-Amino-1,3-benzodioxol-5-yl)-2-pyrrolidinone
  • 2-Pyrrolidinone, 1-(6-amino-1,3-benzodioxol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.