CAS 948007-59-8

1,1-dioxo-2,3-dihydrothieno[2,3-e]thiazin-4-one

Description:

1,1-Dioxo-2,3-dihydrothieno[2,3-e]thiazin-4-one, identified by its CAS number 948007-59-8, is a heterocyclic compound featuring a thiazine ring structure. This compound is characterized by the presence of a dioxo functional group, which contributes to its reactivity and potential biological activity. The thieno[2,3-e]thiazin framework indicates that it contains both sulfur and nitrogen atoms, which can influence its chemical properties, such as solubility and stability. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the dioxo group suggests potential for interactions with biological targets, possibly through mechanisms involving electron transfer or coordination with metal ions. Additionally, the structural features may allow for various substitution patterns, which can further modify its chemical behavior and activity. Overall, this compound represents a unique class of thiazine derivatives with potential applications in drug development and other fields of chemistry.

Formula: C₆H₅NO₃S₂

InChI: InChI=1/C6H5NO3S2/c8-4-3-7-12(9,10)5-1-2-11-6(4)5/h1-2,7H,3H2

SMILES: c1csc2C(=O)CNS(=O)(=O)c12