CymitQuimica logo

CAS 948015-50-7

:

5-Chloro-3-(4-morpholinylsulfonyl)-2-thiophenecarboxylic acid

Description:
5-Chloro-3-(4-morpholinylsulfonyl)-2-thiophenecarboxylic acid is a chemical compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a chloro substituent at the 5-position and a morpholinylsulfonyl group at the 3-position contributes to its unique chemical properties. This compound is likely to exhibit moderate to high solubility in polar solvents due to the sulfonyl and carboxylic acid functional groups, which can engage in hydrogen bonding. The morpholine moiety may enhance its biological activity, potentially making it a candidate for pharmaceutical applications. The compound's structure suggests it may possess acidic properties due to the carboxylic acid group, which can donate protons in solution. Additionally, the presence of the sulfonyl group may impart stability and influence the compound's reactivity. Overall, 5-Chloro-3-(4-morpholinylsulfonyl)-2-thiophenecarboxylic acid is a complex molecule with potential applications in medicinal chemistry and material science.
Formula:C9H10ClNO5S2
InChI:InChI=1S/C9H10ClNO5S2/c10-7-5-6(8(17-7)9(12)13)18(14,15)11-1-3-16-4-2-11/h5H,1-4H2,(H,12,13)
InChI key:InChIKey=YZTUGMIATWHWJZ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(C(O)=O)SC(Cl)=C1)N2CCOCC2
Synonyms:
  • 2-Thiophenecarboxylic acid, 5-chloro-3-(4-morpholinylsulfonyl)-
  • 5-Chloro-3-(4-morpholinylsulfonyl)-2-thiophenecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.