CAS 948027-43-8

(1R,5S)-1,2,3,4,5,6-Hexahydro-9-(3-pyridinyl)-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one

Description:

The chemical substance known as (1R,5S)-1,2,3,4,5,6-Hexahydro-9-(3-pyridinyl)-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one, with the CAS number 948027-43-8, is a complex organic compound characterized by its multi-cyclic structure, which includes both pyridine and diazocine moieties. This compound features a hexahydro framework, indicating the presence of multiple saturated carbon rings, contributing to its stability and potential biological activity. The specific stereochemistry, denoted by the (1R,5S) configuration, suggests that it has distinct spatial arrangements that may influence its interactions with biological targets. The presence of the pyridinyl group indicates potential for interactions with various receptors or enzymes, making it of interest in medicinal chemistry. Additionally, the compound's unique structure may confer specific pharmacological properties, which could be explored in drug development. Overall, this substance exemplifies the complexity and diversity of organic compounds that can be synthesized for potential therapeutic applications.

Formula: C₁₆H₁₇N₃O

InChI: InChI=1S/C16H17N3O/c20-16-14(12-2-1-5-17-8-12)3-4-15-13-6-11(7-18-9-13)10-19(15)16/h1-5,8,11,13,18H,6-7,9-10H2/t11-,13+/m0/s1

InChI key: InChIKey=GOYASQWDLRLAPK-WCQYABFASA-N

SMILES: O=C1N2C([C@@]3(C[C@](C2)(CNC3)[H])[H])=CC=C1C=4C=CC=NC4

Synonyms:

• (1R,5S)-1,2,3,4,5,6-Hexahydro-9-(3-pyridinyl)-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one
• 1,5-Methano-8H-pyrido[1,2-a][1,5]diazocin-8-one, 1,2,3,4,5,6-hexahydro-9-(3-pyridinyl)-, (1R,5S)-
• 3-(Pyridin-3′-yl)-cytisine
• 3-Pyr-Cytisine