
CAS 948044-00-6
:4′-Ethoxy-3-fluoro-1,1′-biphenyl
Description:
4′-Ethoxy-3-fluoro-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an ethoxy group (-OCH2CH3) at the para position and a fluorine atom at the meta position on one of the phenyl rings contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the ethoxy substituent, which can influence its solubility in various solvents. The fluorine atom can enhance the compound's reactivity and stability, making it of interest in various chemical applications, including pharmaceuticals and materials science. Additionally, the compound's structure suggests potential for specific interactions in biological systems, which may be explored in drug design or as a building block in organic synthesis. Overall, 4′-Ethoxy-3-fluoro-1,1′-biphenyl represents a versatile compound with potential utility in both research and industrial applications.
Formula:C14H13FO
InChI:InChI=1S/C14H13FO/c1-2-16-14-8-6-11(7-9-14)12-4-3-5-13(15)10-12/h3-10H,2H2,1H3
InChI key:InChIKey=VHJBNXHEBSFWNK-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1)C2=CC=C(OCC)C=C2
Synonyms:- 1-Ethoxy-4-(3-fluorophenyl)benzene
- 1,1′-Biphenyl, 4′-ethoxy-3-fluoro-
- 4′-Ethoxy-3-fluoro-1,1′-biphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.