CAS 948290-17-3
:2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline
Description:
2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline is a synthetic chemical compound belonging to the quinoline class, characterized by its bicyclic structure that includes a nitrogen atom in the heterocyclic ring. This compound features a chlorine atom at the 2-position, a fluoro group at the 7-position, and a 3-chloropropyl substituent at the 3-position, contributing to its unique reactivity and potential biological activity. The presence of halogen atoms, such as chlorine and fluorine, often enhances the lipophilicity and metabolic stability of the compound, which can be advantageous in pharmaceutical applications. The compound may exhibit antimicrobial or antitumor properties, typical of many quinoline derivatives, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, potentially influencing its pharmacokinetics and pharmacodynamics. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C12H10Cl2FN
InChI:InChI=1S/C12H10Cl2FN/c13-5-1-2-9-6-8-3-4-10(15)7-11(8)16-12(9)14/h3-4,6-7H,1-2,5H2
InChI key:InChIKey=PDSOFMJCDIUSAU-UHFFFAOYSA-N
SMILES:ClC1=NC2=C(C=C1CCCCl)C=CC(F)=C2
Synonyms:- 2-Chloro-3-(3-chloropropyl)-7-fluoroquinoline
- Quinoline, 2-Chloro-3-(3-Chloropropyl)-7-Fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.