CAS 948290-76-4

ethyl 7-fluoro-2-methyl-quinoline-3-carboxylate

Description:

Ethyl 7-fluoro-2-methyl-quinoline-3-carboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of a fluoro group at the 7-position and a methyl group at the 2-position contributes to its unique reactivity and potential biological activity. The ethyl ester functional group at the 3-position enhances its solubility in organic solvents and may influence its pharmacokinetic properties. This compound is likely to exhibit interesting properties such as fluorescence, which is common in quinoline derivatives, and may be explored for applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, the presence of the fluoro substituent may enhance lipophilicity and metabolic stability, which are important factors in the design of effective therapeutic agents.

Formula: C₁₃H₁₂FNO₂

InChI: InChI=1/C13H12FNO2/c1-3-17-13(16)11-6-9-4-5-10(14)7-12(9)15-8(11)2/h4-7H,3H2,1-2H3

SMILES: CCOC(=O)c1cc2ccc(cc2nc1C)F

Synonyms:

• 3-Quinolinecarboxylic Acid, 7-Fluoro-2-Methyl-, Ethyl Ester
• Ethyl 7-fluoro-2-methylquinoline-3-carboxylate