CymitQuimica logo

CAS 948290-82-2

:

diethyl 7-fluoroquinoline-2,3-dicarboxylate

Description:
Diethyl 7-fluoroquinoline-2,3-dicarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound featuring a nitrogen atom in the ring. The presence of the fluoro group at the 7-position enhances its reactivity and may influence its biological activity. The compound contains two ester functional groups, indicated by the diethyl dicarboxylate moiety, which can affect its solubility and reactivity in various chemical environments. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial or anticancer activities. The presence of multiple carboxylate groups can also facilitate interactions with biological targets. Additionally, the compound's molecular structure suggests it may exhibit specific optical properties, making it useful in various applications, including drug development and material science. As with many synthetic organic compounds, safety and handling precautions should be observed, given the potential hazards associated with chemical synthesis and biological testing.
Formula:C15H14FNO4
InChI:InChI=1/C15H14FNO4/c1-3-20-14(18)11-7-9-5-6-10(16)8-12(9)17-13(11)15(19)21-4-2/h5-8H,3-4H2,1-2H3
SMILES:CCOC(=O)c1cc2ccc(cc2nc1C(=O)OCC)F
Synonyms:
  • 2,3-Quinolinedicarboxylic Acid, 7-Fluoro-, Diethyl Ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.