CAS 948291-44-9

2-chloro-3-(chloromethyl)-8-ethyl-quinoline

Description:

2-Chloro-3-(chloromethyl)-8-ethyl-quinoline is a synthetic organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features two chlorine substituents: one at the 2-position and another at the 3-position, specifically as a chloromethyl group. The presence of an ethyl group at the 8-position contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Quinoline derivatives are known for their biological activity, including antimicrobial and antitumor properties, making them of interest in medicinal chemistry. The compound's molecular structure suggests potential interactions with biological targets, which may be explored in drug development. Additionally, the presence of halogen atoms can enhance lipophilicity and alter the electronic properties of the molecule, affecting its behavior in various chemical environments. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₂H₁₁Cl₂N

InChI: InChI=1/C12H11Cl2N/c1-2-8-4-3-5-9-6-10(7-13)12(14)15-11(8)9/h3-6H,2,7H2,1H3

SMILES: CCc1cccc2cc(CCl)c(Cl)nc12

Synonyms:

• 2-Chloro-3-(chloromethyl)-8-ethylquinoline
• Quinoline, 2-Chloro-3-(Chloromethyl)-8-Ethyl-