CAS 948292-54-4
:2-methyl-6-(trifluoromethyl)quinolin-4-amine
Description:
2-Methyl-6-(trifluoromethyl)quinolin-4-amine is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methyl group at the 2-position and a trifluoromethyl group at the 6-position contributes to its unique properties, including increased lipophilicity and potential biological activity. The amine functional group at the 4-position can participate in hydrogen bonding, influencing its solubility and reactivity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the quinoline scaffold can lead to compounds with various pharmacological activities. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioactivity. Overall, 2-methyl-6-(trifluoromethyl)quinolin-4-amine exhibits characteristics typical of heterocyclic amines, making it a valuable compound for further research in chemical and pharmaceutical sciences.
Formula:C11H9F3N2
InChI:InChI=1/C11H9F3N2/c1-6-4-9(15)8-5-7(11(12,13)14)2-3-10(8)16-6/h2-5H,1H3,(H2,15,16)
SMILES:Cc1cc(c2cc(ccc2n1)C(F)(F)F)N
Synonyms:- 4-Quinolinamine, 2-Methyl-6-(Trifluoromethyl)-
- 2-Methyl-6-(trifluoromethyl)quinolin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.