CAS 948293-08-1

6-chloro-8-methyl-quinolin-4-amine

Description:

6-Chloro-8-methyl-quinolin-4-amine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 6-position and a methyl group at the 8-position, along with an amino group at the 4-position, contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic quinoline core. It can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the functional groups present. The amino group can act as a hydrogen bond donor, influencing its interactions in biological systems. Compounds of this type are often studied for their potential pharmacological activities, including antimicrobial and anticancer properties, making them of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₉ClN₂

InChI: InChI=1/C10H9ClN2/c1-6-4-7(11)5-8-9(12)2-3-13-10(6)8/h2-5H,1H3,(H2,12,13)

SMILES: Cc1cc(cc2c(ccnc12)N)Cl

Synonyms:

• 4-Quinolinamine, 6-Chloro-8-Methyl-
• 6-Chloro-8-Methylquinolin-4-Amine

4-Amino-6-chloro-8-methylquinoline

CAS: 948293-08-1

4-Amino-6-chloro-8-methylquinoline

Purity: ≥95%

Molecular weight: 192.64g/mol

Ref: 54-OR307943