CAS 948293-13-8

6-ethoxyquinolin-4-amine

Description:

6-Ethoxyquinolin-4-amine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of an ethoxy group at the 6-position and an amino group at the 4-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic quinoline core. It can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the functional groups present. The amino group can act as a hydrogen bond donor, while the ethoxy group can influence the compound's polarity and reactivity. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of 6-ethoxyquinolin-4-amine have not been extensively studied.

Formula: C₁₁H₁₂N₂O

InChI: InChI=1/C11H12N2O/c1-2-14-8-3-4-11-9(7-8)10(12)5-6-13-11/h3-7H,2H2,1H3,(H2,12,13)

SMILES: CCOc1ccc2c(c1)c(ccn2)N

Synonyms:

• 4-Quinolinamine, 6-Ethoxy-
• 6-Ethoxyquinolin-4-amine

4-Amino-6-ethoxyquinoline

CAS: 948293-13-8

4-Amino-6-ethoxyquinoline

Formula: C₁₁H₁₂N₂O

Purity: 95%

Color and Shape: light brown powder

Molecular weight: 188.22578g/mol

Ref: 54-OR307944