CymitQuimica logo

CAS 948293-26-3

:

1-(2-Fluorophenyl)-3-methyl-1H-pyrazole-5-carboxylic acid

Description:
1-(2-Fluorophenyl)-3-methyl-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its biological activity. The carboxylic acid functional group (-COOH) contributes to its acidity and solubility in polar solvents, making it relevant in various chemical reactions and applications. This compound may exhibit interesting pharmacological properties, as many pyrazole derivatives are known for their biological activities, including anti-inflammatory and analgesic effects. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, the specific arrangement of substituents can affect its reactivity and stability, which are important factors in both synthetic and applied chemistry contexts.
Formula:C11H9FN2O2
InChI:InChI=1S/C11H9FN2O2/c1-7-6-10(11(15)16)14(13-7)9-5-3-2-4-8(9)12/h2-6H,1H3,(H,15,16)
InChI key:InChIKey=XHKBTXNLXBMUBG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N(N=C(C)C1)C2=C(F)C=CC=C2
Synonyms:
  • 1-(2-Fluorophenyl)-3-methyl-1H-pyrazole-5-carboxylic acid
  • 1H-Pyrazole-5-carboxylic acid, 1-(2-fluorophenyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.