
CAS 948294-11-9
:7-Chloro-3-propyl-2-quinolinamine
Description:
7-Chloro-3-propyl-2-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 7-position and a propyl group at the 3-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, though its solubility in water may be limited. The amine functional group imparts basicity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 948294-11-9, is a unique identifier that facilitates its identification in chemical databases. Safety data should be consulted for handling and storage, as compounds with halogen substituents can exhibit varying degrees of toxicity and environmental impact. Overall, 7-Chloro-3-propyl-2-quinolinamine represents a significant compound for research in both synthetic and medicinal chemistry.
Formula:C12H13ClN2
InChI:InChI=1S/C12H13ClN2/c1-2-3-9-6-8-4-5-10(13)7-11(8)15-12(9)14/h4-7H,2-3H2,1H3,(H2,14,15)
InChI key:InChIKey=DKKNWJTZWZHXBM-UHFFFAOYSA-N
SMILES:NC1=NC2=C(C=C1CCC)C=CC(Cl)=C2
Synonyms:- 7-Chloro-3-propyl-2-quinolinamine
- 2-Quinolinamine, 7-chloro-3-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.