CAS 948294-24-4

5-Chloro-8-methyl-3-quinolinecarboxylic acid

Description:

5-Chloro-8-methyl-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a chloro substituent at the 5-position and a methyl group at the 8-position of the quinoline ring, along with a carboxylic acid functional group at the 3-position. The presence of these functional groups contributes to its potential reactivity and solubility properties. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for various interactions, including hydrogen bonding due to the carboxylic acid, and potential electrophilic or nucleophilic reactions due to the electron-rich quinoline system. Additionally, the chlorine atom can influence the compound's lipophilicity and overall stability. As with many quinoline derivatives, this compound may be studied for its applications in medicinal chemistry, particularly in the development of antimicrobial or anticancer agents.

Formula: C₁₁H₈ClNO₂

InChI: InChI=1S/C11H8ClNO2/c1-6-2-3-9(12)8-4-7(11(14)15)5-13-10(6)8/h2-5H,1H3,(H,14,15)

InChI key: InChIKey=CMJTVPDKPRZDHT-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C(C)=CC1)N=CC(C(O)=O)=C2

Synonyms:

• 3-Quinolinecarboxylic Acid, 5-Chloro-8-Methyl-
• 5-Chloro-8-methyl-3-quinolinecarboxylic acid
• 5-Chloro-8-methylquinoline-3-carboxylic acid

5-Chloro-8-methylquinoline-3-carboxylic acid

CAS: 948294-24-4

5-Chloro-8-methylquinoline-3-carboxylic acid

Purity: ≥95%

Molecular weight: 221.64g/mol

Ref: 54-OR307994