CymitQuimica logo

CAS 948294-26-6

:

5-bromo-4-fluoro-2-nitrotoluene

Description:
5-Bromo-4-fluoro-2-nitrotoluene is an aromatic compound characterized by the presence of a toluene backbone substituted with a bromine atom, a fluorine atom, and a nitro group. This compound features a bromine atom at the 5-position, a fluorine atom at the 4-position, and a nitro group at the 2-position of the toluene ring. It is typically a yellow to brown solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of multiple electronegative substituents influences its reactivity, making it a useful compound in electrophilic aromatic substitution reactions. Additionally, the nitro group contributes to its polarity and can affect its solubility in various solvents. Safety precautions should be taken when handling this compound, as it may pose health risks, including toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.
Formula:C7H5BrFNO2
InChI:InChI=1S/C7H5BrFNO2/c1-4-2-5(8)6(9)3-7(4)10(11)12/h2-3H,1H3
InChI key:ZIULASDABKIDOV-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1[N+](=O)[O-])F)Br
Found 5 products.