CymitQuimica logo

CAS 948294-43-7

:

2-Chloro-3-(2-chloroethyl)-6,8-dimethylquinoline

Description:
2-Chloro-3-(2-chloroethyl)-6,8-dimethylquinoline is a synthetic organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features two chlorine substituents, one at the 2-position and another at the 3-position, along with two methyl groups at the 6 and 8 positions of the quinoline ring. The presence of the chloroethyl group enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic structure, which can influence its bioavailability and interaction with biological systems. Additionally, the presence of multiple functional groups may impart specific chemical properties, such as the ability to participate in nucleophilic substitution reactions. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks. Overall, 2-Chloro-3-(2-chloroethyl)-6,8-dimethylquinoline represents a complex structure with potential utility in various chemical applications.
Formula:C13H13Cl2N
InChI:InChI=1S/C13H13Cl2N/c1-8-5-9(2)12-11(6-8)7-10(3-4-14)13(15)16-12/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=ZEZMZEDNHJQDNF-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=C(CCCl)C(Cl)=N2)C=C(C)C1
Synonyms:
  • 2-Chloro-3-(2-chloroethyl)-6,8-dimethylquinoline
  • Quinoline, 2-chloro-3-(2-chloroethyl)-6,8-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.