
CAS 948294-51-7
:2-Chloro-3-(2-chloroethyl)-6-ethylquinoline
Description:
2-Chloro-3-(2-chloroethyl)-6-ethylquinoline is a synthetic organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features two chloro substituents and an ethyl group, contributing to its unique chemical properties. The presence of chlorine atoms enhances its reactivity and potential for forming various derivatives. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with quinoline derivatives. Additionally, its specific functional groups may influence its interactions with biological targets, making it of interest for further research in drug design and synthesis. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.
Formula:C13H13Cl2N
InChI:InChI=1S/C13H13Cl2N/c1-2-9-3-4-12-11(7-9)8-10(5-6-14)13(15)16-12/h3-4,7-8H,2,5-6H2,1H3
InChI key:InChIKey=TZQOXJSXWXQLAR-UHFFFAOYSA-N
SMILES:C(CCl)C1=CC2=C(N=C1Cl)C=CC(CC)=C2
Synonyms:- 2-Chloro-3-(2-chloroethyl)-6-ethylquinoline
- Quinoline, 2-chloro-3-(2-chloroethyl)-6-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.