CAS 948294-56-2

2-chloro-3-(2-chloroethyl)-7-fluoro-quinoline

Description:

2-Chloro-3-(2-chloroethyl)-7-fluoro-quinoline is a synthetic organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features multiple halogen substituents, specifically two chlorine atoms and one fluorine atom, which can significantly influence its chemical reactivity and biological activity. The presence of the chloroethyl group enhances its potential for nucleophilic substitution reactions, while the fluorine atom may impart unique electronic properties. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents. The molecular structure suggests that it may exhibit lipophilicity, which can affect its bioavailability and interaction with biological systems. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific arrangement of its substituents, making it a subject of interest in medicinal chemistry and drug design.

Formula: C₁₁H₈Cl₂FN

InChI: InChI=1/C11H8Cl2FN/c12-4-3-8-5-7-1-2-9(14)6-10(7)15-11(8)13/h1-2,5-6H,3-4H2

SMILES: c1cc(cc2c1cc(CCCl)c(Cl)n2)F

Synonyms:

• 2-Chloro-3-(2-chloroethyl)-7-fluoroquinoline
• Quinoline, 2-Chloro-3-(2-Chloroethyl)-7-Fluoro-