CymitQuimica logo

CAS 948294-65-3

:

2-Chloro-3-(3-chloropropyl)-6-fluoroquinoline

Description:
2-Chloro-3-(3-chloropropyl)-6-fluoroquinoline is a synthetic organic compound belonging to the quinoline class, characterized by a bicyclic structure that includes a nitrogen atom in its aromatic ring. This compound features a chloro substituent at the 2-position, a fluoro group at the 6-position, and a propyl chain with a chlorine atom at the 3-position, contributing to its unique reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of halogen atoms (chlorine and fluorine) often enhances the compound's lipophilicity and can influence its pharmacokinetic properties, making it of interest in medicinal chemistry, particularly in the development of antimicrobial or anticancer agents. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Chloro-3-(3-chloropropyl)-6-fluoroquinoline represents a structurally diverse compound with potential applications in various fields of research.
Formula:C12H10Cl2FN
InChI:InChI=1S/C12H10Cl2FN/c13-5-1-2-8-6-9-7-10(15)3-4-11(9)16-12(8)14/h3-4,6-7H,1-2,5H2
InChI key:InChIKey=CZVZBUGCEREZIC-UHFFFAOYSA-N
SMILES:C(CCCl)C1=CC2=C(N=C1Cl)C=CC(F)=C2
Synonyms:
  • 2-Chloro-3-(3-chloropropyl)-6-fluoroquinoline
  • Quinoline, 2-Chloro-3-(3-Chloropropyl)-6-Fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.