CAS 94832-40-3

4-(Aminooxy)-3-nitrobenzoic acid

Description:

4-(Aminooxy)-3-nitrobenzoic acid, with the CAS number 94832-40-3, is an organic compound characterized by the presence of an aminooxy group and a nitro group attached to a benzoic acid structure. This compound typically appears as a solid and is soluble in polar solvents due to its carboxylic acid functionality. The aminooxy group (-NH2O-) is known for its ability to form stable conjugates with carbonyl compounds, making this substance useful in various chemical reactions, particularly in bioconjugation and as a potential tool in medicinal chemistry. The nitro group (-NO2) can influence the compound's reactivity and electronic properties, often enhancing its electrophilicity. Additionally, the presence of both functional groups suggests potential applications in drug development, particularly in targeting specific biological pathways. Overall, 4-(Aminooxy)-3-nitrobenzoic acid serves as a versatile building block in synthetic organic chemistry and may have implications in research related to drug design and development.

Formula: C₇H₆N₂O₅

InChI: InChI=1S/C7H6N2O5/c8-14-6-2-1-4(7(10)11)3-5(6)9(12)13/h1-3H,8H2,(H,10,11)

InChI key: InChIKey=GFKDWTCZBNLORQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(ON)C=CC(C(O)=O)=C1

Synonyms:

• 4-(Aminooxy)-3-nitrobenzoic acid
• Benzoic acid, 4-(aminooxy)-3-nitro-