CAS 94840-66-1
:S-(1,1,2,2-tetrafluoroethyl)-L-cysteine
Description:
S-(1,1,2,2-tetrafluoroethyl)-L-cysteine is a synthetic amino acid derivative characterized by the presence of a tetrafluoroethyl group attached to the sulfur atom of the cysteine backbone. This modification imparts unique properties, such as increased hydrophobicity and potential for enhanced stability against oxidation. The compound retains the thiol (-SH) functional group typical of cysteine, which can participate in redox reactions and form disulfide bonds, making it relevant in biochemical applications. Its fluorinated structure may also influence its interaction with biological systems, potentially affecting protein folding and function. The presence of fluorine atoms can enhance lipophilicity and alter the compound's reactivity compared to non-fluorinated analogs. S-(1,1,2,2-tetrafluoroethyl)-L-cysteine is of interest in medicinal chemistry and materials science, where its unique properties can be exploited for drug design or as a building block in the synthesis of fluorinated compounds. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C5H7F4NO2S
InChI:InChI=1/C5H7F4NO2S/c6-4(7)5(8,9)13-1-2(10)3(11)12/h2,4H,1,10H2,(H,11,12)/t2-/m0/s1
SMILES:C([C@@H](C(=O)O)N)SC(C(F)F)(F)F
Synonyms:- L-cysteine, S-(1,1,2,2-tetrafluoroethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.