CAS 948549-53-9

3-bromo-4-chloro-benzonitrile

Description:

3-Bromo-4-chloro-benzonitrile is an organic compound characterized by the presence of both bromine and chlorine substituents on a benzene ring, along with a nitrile functional group. The compound features a benzene ring with a bromine atom at the meta position (3-position) and a chlorine atom at the para position (4-position) relative to the nitrile group (-C≡N). This structural arrangement contributes to its unique chemical properties, including its reactivity and potential applications in organic synthesis and pharmaceuticals. The presence of the nitrile group imparts polarity, making the compound soluble in polar solvents. Additionally, the halogen substituents can influence the compound's electronic properties, affecting its reactivity in nucleophilic substitution reactions. 3-Bromo-4-chloro-benzonitrile is typically used as an intermediate in the synthesis of various chemical compounds, including agrochemicals and pharmaceuticals. Safety precautions should be observed when handling this compound, as it may pose health risks due to the presence of halogens and the nitrile group.

Formula: C₇H₃BrClN

InChI: InChI=1/C7H3BrClN/c8-6-3-5(4-10)1-2-7(6)9/h1-3H

SMILES: c1cc(c(cc1C#N)Br)Cl

Synonyms:

• 3-Bromo-4-Chlorobenzonitrile
• Benzonitrile, 3-bromo-4-chloro-

3-Bromo-4-chlorobenzonitrile

CAS: 948549-53-9

Formula: C₇H₃BrClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 216.4624

Ref: IN-DA003J1I

3-Bromo-4-chlorobenzonitrile

CAS: 948549-53-9

3-Bromo-4-chlorobenzonitrile

Purity: 98%

Molecular weight: 216.46g/mol

Ref: 54-OR350429

3-Bromo-4-chlorobenzonitrile

CAS: 948549-53-9

Formula: C₇H₃BrClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 216.46

Ref: 10-F035815