CymitQuimica logo

CAS 948549-74-4

:

2-(cyclopropylamino)pyrimidine-4-carbaldehyde

Description:
2-(Cyclopropylamino)pyrimidine-4-carbaldehyde is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a cyclopropylamino group at the 2-position introduces a unique structural feature that can influence the compound's reactivity and biological activity. The aldehyde functional group at the 4-position is notable for its reactivity, particularly in condensation reactions and as a potential electrophile in various organic transformations. This compound may exhibit properties such as solubility in polar solvents, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The presence of both nitrogen atoms and the aldehyde group may also contribute to hydrogen bonding capabilities, influencing its interaction with biological macromolecules. Overall, 2-(cyclopropylamino)pyrimidine-4-carbaldehyde is a versatile compound with potential implications in various fields, including drug discovery and organic synthesis.
Formula:C8H9N3O
InChI:InChI=1/C8H9N3O/c12-5-7-3-4-9-8(11-7)10-6-1-2-6/h3-6H,1-2H2,(H,9,10,11)
SMILES:C1CC1Nc1nccc(C=O)n1
Synonyms:
  • 4-Pyrimidinecarboxaldehyde, 2-(Cyclopropylamino)-
  • 2-(Cyclopropylamino)pyrimidine-4-carbaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.