CAS 948550-81-0
:6-(2,6-Dichlorophenoxy)pyrimidine-2,4-diamine
Description:
6-(2,6-Dichlorophenoxy)pyrimidine-2,4-diamine is a chemical compound characterized by its pyrimidine core, which is substituted at the 6-position with a 2,6-dichlorophenoxy group and at the 2 and 4 positions with amino groups. This structure contributes to its potential biological activity, particularly in the field of pharmaceuticals. The presence of the dichlorophenoxy moiety may enhance its lipophilicity and influence its interaction with biological targets. The compound is likely to exhibit properties such as solubility in organic solvents, and its stability can be affected by environmental factors like pH and temperature. As a diamine, it may participate in various chemical reactions, including those typical of amines, such as nucleophilic substitutions or coupling reactions. The compound's specific applications and efficacy would depend on its interaction with biological systems, making it of interest for further research in medicinal chemistry and related fields. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C10H8Cl2N4O
InChI:InChI=1/C10H8Cl2N4O/c11-5-2-1-3-6(12)9(5)17-8-4-7(13)15-10(14)16-8/h1-4H,(H4,13,14,15,16)
SMILES:c1cc(c(c(c1)Cl)Oc1cc(N)[nH]c(=N)n1)Cl
Synonyms:- 2,4-Pyrimidinediamine, 6-(2,6-Dichlorophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
