CAS 948553-14-8
:4-(Bromomethyl)-3-(trifluoromethyl)-Benzoylchloride
Description:
4-(Bromomethyl)-3-(trifluoromethyl)-benzoyl chloride is an organic compound characterized by its functional groups and structural features. It contains a benzoyl chloride moiety, which is a derivative of benzoic acid where the hydroxyl group is replaced by a chlorine atom, making it reactive towards nucleophiles. The presence of a bromomethyl group indicates that a bromine atom is attached to a carbon adjacent to the carbonyl group, enhancing its electrophilic character. Additionally, the trifluoromethyl group contributes to the compound's unique properties, such as increased lipophilicity and potential biological activity, due to the electronegative fluorine atoms. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules, and may exhibit interesting reactivity patterns due to its halogen substituents. Safety precautions should be taken when handling this compound, as it may be hazardous due to the presence of reactive halogen atoms and the potential for toxic byproducts during reactions.
Formula:C9H5BrClF3O
InChI:InChI=1/C9H5BrClF3O/c10-4-6-2-1-5(8(11)15)3-7(6)9(12,13)14/h1-3H,4H2
SMILES:c1cc(CBr)c(cc1C(=O)Cl)C(F)(F)F
Synonyms:- 4-(Bromomethyl)-3-(trifluoromethyl)benzoyl chloride
- Benzoyl Chloride, 4-(Bromomethyl)-3-(Trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(Bromomethyl)-3-(trifluoromethyl)benzoyl chloride
CAS:4-(Bromomethyl)-3-(trifluoromethyl)benzoyl chloride
Molecular weight:301.48761g/mol

