
CAS 94857-18-8
:2-Naphthalenecarboxylic acid, 6-hydroxy-, homopolymer
Description:
2-Naphthalenecarboxylic acid, 6-hydroxy-, homopolymer, identified by CAS number 94857-18-8, is a synthetic polymer derived from the polymerization of 2-naphthalenecarboxylic acid and its derivatives. This compound exhibits characteristics typical of aromatic polycarboxylic acids, including good thermal stability and resistance to degradation. The presence of hydroxyl groups contributes to its potential for hydrogen bonding, enhancing solubility in polar solvents and influencing its physical properties. The polymer's structure allows for a degree of rigidity due to the naphthalene rings, which can also impart UV stability and chemical resistance. Applications may include use in coatings, adhesives, and as a modifier in various polymer blends, owing to its ability to improve mechanical properties and thermal performance. Additionally, the polymer's functional groups can facilitate further chemical modifications, making it versatile for various industrial applications. Overall, this compound represents a valuable material in the field of polymer chemistry, with potential uses across multiple sectors.
Formula:(C11H8O3)x
InChI:InChI=1S/C11H8O3/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6,12H,(H,13,14)
InChI key:InChIKey=KAUQJMHLAFIZDU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC2=C(C=C(O)C=C2)C=C1
Synonyms:- 2-Naphthalenecarboxylic acid, 6-hydroxy-, homopolymer
- 6-Hydroxy-2-naphthoic acid homopolymer
- 2-Hydroxy-6-naphthoic acid homopolymer
- Poly(6-hydroxy-2-naphthoic acid)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
