CymitQuimica logo

CAS 948573-55-5

:

1,4-Dihydro-4-oxo-7-quinolinecarboxylic acid

Description:
1,4-Dihydro-4-oxo-7-quinolinecarboxylic acid, with the CAS number 948573-55-5, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline ring system, which is characterized by a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a carboxylic acid functional group contributes to its acidic properties, while the 4-oxo group indicates the presence of a carbonyl functional group at the 4-position of the ring. This compound may exhibit biological activity, potentially serving as a scaffold for the development of pharmaceuticals or agrochemicals. Its structural features suggest it could participate in various chemical reactions, including those typical of carboxylic acids and ketones. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it of interest in both synthetic and medicinal chemistry. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C10H7NO3
InChI:InChI=1S/C10H7NO3/c12-9-3-4-11-8-5-6(10(13)14)1-2-7(8)9/h1-5H,(H,11,12)(H,13,14)
InChI key:InChIKey=QNDMXIULYGYMJK-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(C(O)=O)=CC2)NC=C1
Synonyms:
  • 1,4-Dihydro-4-oxo-7-quinolinecarboxylic acid
  • 7-Carboxy-1,4-dihydroquinolin-4-one
  • 7-Quinolinecarboxylic acid, 1,4-dihydro-4-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.